C21H20N2O4 — CID 19177137
methyl 3-[[(E)-2-cyano-3-(4-propoxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 19177137) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is methyl 3-[[(E)-2-cyano-3-(4-propoxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 3-[[(E)-2-cyano-3-(4-propoxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 19177137 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | methyl 3-[[(E)-2-cyano-3-(4-propoxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | CCCOc1ccc(/C=C(\C#N)C(=O)Nc2cccc(C(=O)OC)c2)cc1 |
| InChI | InChI=1S/C21H20N2O4/c1-3-11-27-19-9-7-15(8-10-19)12-17(14-22)20(24)23-18-6-4-5-16(13-18)21(25)26-2/h4-10,12-13H,3,11H2,1-2H3,(H,23,24)/b17-12+ |
| InChIKey | XOQQUYPDSAWPOT-SFQUDFHCSA-N |
| XLogP | 3.81 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|