(4-propylphenyl) 2-(4-chloro-3-methylphenoxy)acetate

C18H19ClO3 — CID 19179045

IUPAC(4-propylphenyl) 2-(4-chloro-3-methylphenoxy)acetate
SMILESCCCc1ccc(OC(=O)COc2ccc(Cl)c(C)c2)cc1
InChIInChI=1S/C18H19ClO3/c1-3-4-14-5-7-15(8-6-14)22-18(20)12-21-16-9-10-17(19)13(2)11-16/h5-11H,3-4,12H2,1-2H3
InChIKeyJDJFMJDRSTUUFO-UHFFFAOYSA-N
MW318.80 g/mol
LogP4.59
Rot. Bonds6

About (4-propylphenyl) 2-(4-chloro-3-methylphenoxy)acetate

(4-propylphenyl) 2-(4-chloro-3-methylphenoxy)acetate (PubChem CID 19179045) has the molecular formula C18H19ClO3 and a molecular weight of 318.80 g/mol. Its IUPAC name is (4-propylphenyl) 2-(4-chloro-3-methylphenoxy)acetate.

Molecular Properties

Compound Name(4-propylphenyl) 2-(4-chloro-3-methylphenoxy)acetate
PubChem CID19179045
Molecular FormulaC18H19ClO3
Molecular Weight318.80 g/mol
Exact Mass318.10
IUPAC Name(4-propylphenyl) 2-(4-chloro-3-methylphenoxy)acetate
SMILESCCCc1ccc(OC(=O)COc2ccc(Cl)c(C)c2)cc1
InChIInChI=1S/C18H19ClO3/c1-3-4-14-5-7-15(8-6-14)22-18(20)12-21-16-9-10-17(19)13(2)11-16/h5-11H,3-4,12H2,1-2H3
InChIKeyJDJFMJDRSTUUFO-UHFFFAOYSA-N
XLogP4.59
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.80
LogP ≤ 54.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (4-propylphenyl) 2-(4-chloro-3-methylphenoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-propylphenyl) 2-(4-chloro-3-methylphenoxy)acetate?
The IUPAC name of (4-propylphenyl) 2-(4-chloro-3-methylphenoxy)acetate (CID 19179045) is (4-propylphenyl) 2-(4-chloro-3-methylphenoxy)acetate.
What is the SMILES notation for (4-propylphenyl) 2-(4-chloro-3-methylphenoxy)acetate?
The canonical SMILES for (4-propylphenyl) 2-(4-chloro-3-methylphenoxy)acetate is CCCc1ccc(OC(=O)COc2ccc(Cl)c(C)c2)cc1.
What is the InChIKey of (4-propylphenyl) 2-(4-chloro-3-methylphenoxy)acetate?
The InChIKey is JDJFMJDRSTUUFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClO3/c1-3-4-14-5-7-15(8-6-14)22-18(20)12-21-16-9-10-17(19)13(2)11-16/h5-11H,3-4,12H2,1-2H3.
What are the key properties of (4-propylphenyl) 2-(4-chloro-3-methylphenoxy)acetate?
(4-propylphenyl) 2-(4-chloro-3-methylphenoxy)acetate has a molecular weight of 318.80 g/mol, XLogP of 4.59, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propylphenyl) 2-(4-chloro-3-methylphenoxy)acetate is sourced from PubChem (CID 19179045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).