C21H14Cl3NO4 — CID 19179674
[4-[(4-chlorophenyl)carbamoyl]phenyl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 19179674) has the molecular formula C21H14Cl3NO4 and a molecular weight of 450.71 g/mol. Its IUPAC name is [4-[(4-chlorophenyl)carbamoyl]phenyl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [4-[(4-chlorophenyl)carbamoyl]phenyl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 19179674 |
| Molecular Formula | C21H14Cl3NO4 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 449.00 |
| IUPAC Name | [4-[(4-chlorophenyl)carbamoyl]phenyl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)Oc1ccc(C(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H14Cl3NO4/c22-14-3-6-16(7-4-14)25-21(27)13-1-8-17(9-2-13)29-20(26)12-28-19-10-5-15(23)11-18(19)24/h1-11H,12H2,(H,25,27) |
| InChIKey | OUJNQRFAELFNTD-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|