C23H22O3 — CID 19180769
(3,4-dimethylphenyl) 2-[4-(4-methylphenyl)phenoxy]acetate (PubChem CID 19180769) has the molecular formula C23H22O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is (3,4-dimethylphenyl) 2-[4-(4-methylphenyl)phenoxy]acetate.
| Compound Name | (3,4-dimethylphenyl) 2-[4-(4-methylphenyl)phenoxy]acetate |
|---|---|
| PubChem CID | 19180769 |
| Molecular Formula | C23H22O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (3,4-dimethylphenyl) 2-[4-(4-methylphenyl)phenoxy]acetate |
| SMILES | Cc1ccc(-c2ccc(OCC(=O)Oc3ccc(C)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C23H22O3/c1-16-4-7-19(8-5-16)20-9-12-21(13-10-20)25-15-23(24)26-22-11-6-17(2)18(3)14-22/h4-14H,15H2,1-3H3 |
| InChIKey | JJFVHHFZZSEPTM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|