C20H38N3+3 — CID 19181340
(1S,2R,7R,9S,10S)-1-[(2R)-piperidin-1-ium-2-yl]-3,15-diazoniatetracyclo[7.7.1.02,7.010,15]heptadecane (PubChem CID 19181340) has the molecular formula C20H38N3+3 and a molecular weight of 320.55 g/mol. Its IUPAC name is (1S,2R,7R,9S,10S)-1-[(2R)-piperidin-1-ium-2-yl]-3,15-diazoniatetracyclo[7.7.1.02,7.010,15]heptadecane.
| Compound Name | (1S,2R,7R,9S,10S)-1-[(2R)-piperidin-1-ium-2-yl]-3,15-diazoniatetracyclo[7.7.1.02,7.010,15]heptadecane |
|---|---|
| PubChem CID | 19181340 |
| Molecular Formula | C20H38N3+3 |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.30 |
| IUPAC Name | (1S,2R,7R,9S,10S)-1-[(2R)-piperidin-1-ium-2-yl]-3,15-diazoniatetracyclo[7.7.1.02,7.010,15]heptadecane |
| SMILES | C1CC[C@H]([C@@]23C[C@H](C[C@H]4CCC[NH2+][C@H]42)[C@@H]2CCCC[NH+]2C3)[NH2+]C1 |
| InChI | InChI=1S/C20H35N3/c1-3-9-21-18(8-1)20-13-16(12-15-6-5-10-22-19(15)20)17-7-2-4-11-23(17)14-20/h15-19,21-22H,1-14H2/p+3/t15-,16+,17+,18-,19-,20+/m1/s1 |
| InChIKey | YUKCLPPRYNXRAF-YRIPFXIYSA-Q |
| XLogP | -0.71 |
| TPSA | 37.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |