C16H15ClFNO3S2 — CID 19182403
ethyl 4-[(5Z)-5-[(2-chloro-6-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate (PubChem CID 19182403) has the molecular formula C16H15ClFNO3S2 and a molecular weight of 387.89 g/mol. Its IUPAC name is ethyl 4-[(5Z)-5-[(2-chloro-6-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | ethyl 4-[(5Z)-5-[(2-chloro-6-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 19182403 |
| Molecular Formula | C16H15ClFNO3S2 |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | ethyl 4-[(5Z)-5-[(2-chloro-6-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
| SMILES | CCOC(=O)CCCN1C(=O)/C(=C/c2c(F)cccc2Cl)SC1=S |
| InChI | InChI=1S/C16H15ClFNO3S2/c1-2-22-14(20)7-4-8-19-15(21)13(24-16(19)23)9-10-11(17)5-3-6-12(10)18/h3,5-6,9H,2,4,7-8H2,1H3/b13-9- |
| InChIKey | KMZHDGDQPWJQJJ-LCYFTJDESA-N |
| XLogP | 4.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|