C14H16N2O3 — CID 19183535
(Z)-2-cyano-3-(4-hydroxy-3-methoxyphenyl)-N-propylprop-2-enamide (PubChem CID 19183535) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4-hydroxy-3-methoxyphenyl)-N-propylprop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4-hydroxy-3-methoxyphenyl)-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 19183535 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (Z)-2-cyano-3-(4-hydroxy-3-methoxyphenyl)-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)/C(C#N)=C\c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C14H16N2O3/c1-3-6-16-14(18)11(9-15)7-10-4-5-12(17)13(8-10)19-2/h4-5,7-8,17H,3,6H2,1-2H3,(H,16,18)/b11-7- |
| InChIKey | UOFXZCHDBUTKDR-XFFZJAGNSA-N |
| XLogP | 1.83 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|