About (2-tert-butyl-4-methylphenyl) 2-methoxyacetate
(2-tert-butyl-4-methylphenyl) 2-methoxyacetate (PubChem CID 19184240) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is (2-tert-butyl-4-methylphenyl) 2-methoxyacetate.
Molecular Properties
| Compound Name | (2-tert-butyl-4-methylphenyl) 2-methoxyacetate |
| PubChem CID | 19184240 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (2-tert-butyl-4-methylphenyl) 2-methoxyacetate |
| SMILES | COCC(=O)Oc1ccc(C)cc1C(C)(C)C |
| InChI | InChI=1S/C14H20O3/c1-10-6-7-12(17-13(15)9-16-5)11(8-10)14(2,3)4/h6-8H,9H2,1-5H3 |
| InChIKey | AYTNWNZGPDCMBE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-tert-butyl-4-methylphenyl) 2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butyl-4-methylphenyl) 2-methoxyacetate?
The IUPAC name of (2-tert-butyl-4-methylphenyl) 2-methoxyacetate (CID 19184240) is (2-tert-butyl-4-methylphenyl) 2-methoxyacetate.
What is the SMILES notation for (2-tert-butyl-4-methylphenyl) 2-methoxyacetate?
The canonical SMILES for (2-tert-butyl-4-methylphenyl) 2-methoxyacetate is COCC(=O)Oc1ccc(C)cc1C(C)(C)C.
What is the InChIKey of (2-tert-butyl-4-methylphenyl) 2-methoxyacetate?
The InChIKey is AYTNWNZGPDCMBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-10-6-7-12(17-13(15)9-16-5)11(8-10)14(2,3)4/h6-8H,9H2,1-5H3.
What are the key properties of (2-tert-butyl-4-methylphenyl) 2-methoxyacetate?
(2-tert-butyl-4-methylphenyl) 2-methoxyacetate has a molecular weight of 236.31 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butyl-4-methylphenyl) 2-methoxyacetate is sourced from PubChem (CID 19184240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).