About [2-oxo-3-(propylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate
[2-oxo-3-(propylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate (PubChem CID 19187496) has the molecular formula C27H26N2O7
and a molecular weight of 490.51 g/mol. Its IUPAC name is [2-oxo-3-(propylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate.
Molecular Properties
| Compound Name | [2-oxo-3-(propylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate |
| PubChem CID | 19187496 |
| Molecular Formula | C27H26N2O7 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | [2-oxo-3-(propylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate |
| SMILES | CCCNC(=O)c1cc2ccc(OC(=O)CCCCCN3C(=O)c4ccccc4C3=O)cc2oc1=O |
| InChI | InChI=1S/C27H26N2O7/c1-2-13-28-24(31)21-15-17-11-12-18(16-22(17)36-27(21)34)35-23(30)10-4-3-7-14-29-25(32)19-8-5-6-9-20(19)26(29)33/h5-6,8-9,11-12,15-16H,2-4,7,10,13-14H2,1H3,(H,28,31) |
| InChIKey | UJMDTRVGZYLQLI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-3-(propylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-3-(propylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate?
The IUPAC name of [2-oxo-3-(propylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate (CID 19187496) is [2-oxo-3-(propylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate.
What is the SMILES notation for [2-oxo-3-(propylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate?
The canonical SMILES for [2-oxo-3-(propylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate is CCCNC(=O)c1cc2ccc(OC(=O)CCCCCN3C(=O)c4ccccc4C3=O)cc2oc1=O.
What is the InChIKey of [2-oxo-3-(propylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate?
The InChIKey is UJMDTRVGZYLQLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N2O7/c1-2-13-28-24(31)21-15-17-11-12-18(16-22(17)36-27(21)34)35-23(30)10-4-3-7-14-29-25(32)19-8-5-6-9-20(19)26(29)33/h5-6,8-9,11-12,15-16H,2-4,7,10,13-14H2,1H3,(H,28,31).
What are the key properties of [2-oxo-3-(propylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate?
[2-oxo-3-(propylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate has a molecular weight of 490.51 g/mol, XLogP of 3.69, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-3-(propylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate is sourced from PubChem (CID 19187496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).