C19H26N2O3S — CID 19187732
cyclohexyl 4-(pentanoylcarbamothioylamino)benzoate (PubChem CID 19187732) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is cyclohexyl 4-(pentanoylcarbamothioylamino)benzoate.
| Compound Name | cyclohexyl 4-(pentanoylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 19187732 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | cyclohexyl 4-(pentanoylcarbamothioylamino)benzoate |
| SMILES | CCCCC(=O)NC(=S)Nc1ccc(C(=O)OC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H26N2O3S/c1-2-3-9-17(22)21-19(25)20-15-12-10-14(11-13-15)18(23)24-16-7-5-4-6-8-16/h10-13,16H,2-9H2,1H3,(H2,20,21,22,25) |
| InChIKey | MIBNBGGAGUTTBN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|