About 2-phenoxyacetic acid
2-phenoxyacetic acid (PubChem CID 19188) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is 2-phenoxyacetic acid.
Molecular Properties
| Compound Name | 2-phenoxyacetic acid |
| PubChem CID | 19188 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 2-phenoxyacetic acid |
| SMILES | O=C(O)COc1ccccc1 |
| InChI | InChI=1S/C8H8O3/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10) |
| InChIKey | LCPDWSOZIOUXRV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenoxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxyacetic acid?
The IUPAC name of 2-phenoxyacetic acid (CID 19188) is 2-phenoxyacetic acid.
What is the SMILES notation for 2-phenoxyacetic acid?
The canonical SMILES for 2-phenoxyacetic acid is O=C(O)COc1ccccc1.
What is the InChIKey of 2-phenoxyacetic acid?
The InChIKey is LCPDWSOZIOUXRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10).
What are the key properties of 2-phenoxyacetic acid?
2-phenoxyacetic acid has a molecular weight of 152.15 g/mol, XLogP of 1.15, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxyacetic acid is sourced from PubChem (CID 19188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).