C19H28N2O2S — CID 19188061
N-(cyclohexylcarbamothioyl)-2-(3-methyl-4-propan-2-ylphenoxy)acetamide (PubChem CID 19188061) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is N-(cyclohexylcarbamothioyl)-2-(3-methyl-4-propan-2-ylphenoxy)acetamide.
| Compound Name | N-(cyclohexylcarbamothioyl)-2-(3-methyl-4-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 19188061 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | N-(cyclohexylcarbamothioyl)-2-(3-methyl-4-propan-2-ylphenoxy)acetamide |
| SMILES | Cc1cc(OCC(=O)NC(=S)NC2CCCCC2)ccc1C(C)C |
| InChI | InChI=1S/C19H28N2O2S/c1-13(2)17-10-9-16(11-14(17)3)23-12-18(22)21-19(24)20-15-7-5-4-6-8-15/h9-11,13,15H,4-8,12H2,1-3H3,(H2,20,21,22,24) |
| InChIKey | NVPPFGXMJABCFE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|