C28H22BrClN2O3 — CID 19189850
2-(2-bromo-4-phenylphenoxy)-N-[(E)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 19189850) has the molecular formula C28H22BrClN2O3 and a molecular weight of 549.85 g/mol. Its IUPAC name is 2-(2-bromo-4-phenylphenoxy)-N-[(E)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-phenylphenoxy)-N-[(E)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 19189850 |
| Molecular Formula | C28H22BrClN2O3 |
| Molecular Weight | 549.85 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | 2-(2-bromo-4-phenylphenoxy)-N-[(E)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1Br)N/N=C/c1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C28H22BrClN2O3/c29-25-16-22(21-6-2-1-3-7-21)12-15-27(25)35-19-28(33)32-31-17-20-10-13-24(14-11-20)34-18-23-8-4-5-9-26(23)30/h1-17H,18-19H2,(H,32,33)/b31-17+ |
| InChIKey | WACKSFQUAMJIOJ-KBVAKVRCSA-N |
| XLogP | 6.88 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.85 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|