C17H15BrN2O4 — CID 19190233
4-[(E)-[[2-(4-bromo-3-methylphenoxy)acetyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 19190233) has the molecular formula C17H15BrN2O4 and a molecular weight of 391.22 g/mol. Its IUPAC name is 4-[(E)-[[2-(4-bromo-3-methylphenoxy)acetyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-[(E)-[[2-(4-bromo-3-methylphenoxy)acetyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 19190233 |
| Molecular Formula | C17H15BrN2O4 |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 4-[(E)-[[2-(4-bromo-3-methylphenoxy)acetyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | Cc1cc(OCC(=O)N/N=C/c2ccc(C(=O)O)cc2)ccc1Br |
| InChI | InChI=1S/C17H15BrN2O4/c1-11-8-14(6-7-15(11)18)24-10-16(21)20-19-9-12-2-4-13(5-3-12)17(22)23/h2-9H,10H2,1H3,(H,20,21)(H,22,23)/b19-9+ |
| InChIKey | VHNHQAKBVNCMHM-DJKKODMXSA-N |
| XLogP | 2.98 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|