C24H23BrN2O4 — CID 19190663
2-(2-bromo-4-phenylphenoxy)-N-[(E)-(2-ethoxy-3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 19190663) has the molecular formula C24H23BrN2O4 and a molecular weight of 483.36 g/mol. Its IUPAC name is 2-(2-bromo-4-phenylphenoxy)-N-[(E)-(2-ethoxy-3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-phenylphenoxy)-N-[(E)-(2-ethoxy-3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 19190663 |
| Molecular Formula | C24H23BrN2O4 |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 2-(2-bromo-4-phenylphenoxy)-N-[(E)-(2-ethoxy-3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1c(/C=N/NC(=O)COc2ccc(-c3ccccc3)cc2Br)cccc1OC |
| InChI | InChI=1S/C24H23BrN2O4/c1-3-30-24-19(10-7-11-22(24)29-2)15-26-27-23(28)16-31-21-13-12-18(14-20(21)25)17-8-5-4-6-9-17/h4-15H,3,16H2,1-2H3,(H,27,28)/b26-15+ |
| InChIKey | VPXVBALYENAPGA-CVKSISIWSA-N |
| XLogP | 5.05 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|