C16H18ClNO3 — CID 19191627
2-(4-chloro-3,5-dimethylphenoxy)-N-(furan-2-ylmethyl)propanamide (PubChem CID 19191627) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-N-(furan-2-ylmethyl)propanamide.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-(furan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 19191627 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-(furan-2-ylmethyl)propanamide |
| SMILES | Cc1cc(OC(C)C(=O)NCc2ccco2)cc(C)c1Cl |
| InChI | InChI=1S/C16H18ClNO3/c1-10-7-14(8-11(2)15(10)17)21-12(3)16(19)18-9-13-5-4-6-20-13/h4-8,12H,9H2,1-3H3,(H,18,19) |
| InChIKey | DYPVKWVHJUMJLW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |