C23H25ClN2O3S — CID 19194806
N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-(4-chloro-2-methylphenoxy)propanamide (PubChem CID 19194806) has the molecular formula C23H25ClN2O3S and a molecular weight of 444.98 g/mol. Its IUPAC name is N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-(4-chloro-2-methylphenoxy)propanamide.
| Compound Name | N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-(4-chloro-2-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 19194806 |
| Molecular Formula | C23H25ClN2O3S |
| Molecular Weight | 444.98 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-(4-chloro-2-methylphenoxy)propanamide |
| SMILES | CCCCOc1ccc(-c2csc(NC(=O)C(C)Oc3ccc(Cl)cc3C)n2)cc1 |
| InChI | InChI=1S/C23H25ClN2O3S/c1-4-5-12-28-19-9-6-17(7-10-19)20-14-30-23(25-20)26-22(27)16(3)29-21-11-8-18(24)13-15(21)2/h6-11,13-14,16H,4-5,12H2,1-3H3,(H,25,26,27) |
| InChIKey | BRLGTLKEJFAJOA-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.98 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|