C21H21ClN2O3S — CID 19196624
N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-(2-chlorophenoxy)acetamide (PubChem CID 19196624) has the molecular formula C21H21ClN2O3S and a molecular weight of 416.93 g/mol. Its IUPAC name is N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-(2-chlorophenoxy)acetamide.
| Compound Name | N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-(2-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 19196624 |
| Molecular Formula | C21H21ClN2O3S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-(2-chlorophenoxy)acetamide |
| SMILES | CCCCOc1ccc(-c2csc(NC(=O)COc3ccccc3Cl)n2)cc1 |
| InChI | InChI=1S/C21H21ClN2O3S/c1-2-3-12-26-16-10-8-15(9-11-16)18-14-28-21(23-18)24-20(25)13-27-19-7-5-4-6-17(19)22/h4-11,14H,2-3,12-13H2,1H3,(H,23,24,25) |
| InChIKey | WRHIHEFGNSABPG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|