C18H14N2O3S2 — CID 19197767
methyl 2-[(5Z)-4-oxo-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate (PubChem CID 19197767) has the molecular formula C18H14N2O3S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is methyl 2-[(5Z)-4-oxo-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate.
| Compound Name | methyl 2-[(5Z)-4-oxo-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 19197767 |
| Molecular Formula | C18H14N2O3S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | methyl 2-[(5Z)-4-oxo-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
| SMILES | COC(=O)C(c1ccccc1)N1C(=O)/C(=C/c2ccccn2)SC1=S |
| InChI | InChI=1S/C18H14N2O3S2/c1-23-17(22)15(12-7-3-2-4-8-12)20-16(21)14(25-18(20)24)11-13-9-5-6-10-19-13/h2-11,15H,1H3/b14-11- |
| InChIKey | DIQDEFJFRGOFQY-KAMYIIQDSA-N |
| XLogP | 3.20 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|