C7H5Cl6N3 — CID 19198
2-ethyl-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 19198) has the molecular formula C7H5Cl6N3 and a molecular weight of 343.86 g/mol. Its IUPAC name is 2-ethyl-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-ethyl-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 19198 |
| Molecular Formula | C7H5Cl6N3 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 340.86 |
| IUPAC Name | 2-ethyl-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | CCc1nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C7H5Cl6N3/c1-2-3-14-4(6(8,9)10)16-5(15-3)7(11,12)13/h2H2,1H3 |
| InChIKey | GUUAOSSDSPBIJR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|