C24H25NO6S2 — CID 19198409
propyl 2-[(5Z)-4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]-2-phenylacetate (PubChem CID 19198409) has the molecular formula C24H25NO6S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is propyl 2-[(5Z)-4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]-2-phenylacetate.
| Compound Name | propyl 2-[(5Z)-4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 19198409 |
| Molecular Formula | C24H25NO6S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | propyl 2-[(5Z)-4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]-2-phenylacetate |
| SMILES | CCCOC(=O)C(c1ccccc1)N1C(=O)/C(=C/c2cc(OC)c(OC)c(OC)c2)SC1=S |
| InChI | InChI=1S/C24H25NO6S2/c1-5-11-31-23(27)20(16-9-7-6-8-10-16)25-22(26)19(33-24(25)32)14-15-12-17(28-2)21(30-4)18(13-15)29-3/h6-10,12-14,20H,5,11H2,1-4H3/b19-14- |
| InChIKey | JDNUWHKDBBKDQQ-RGEXLXHISA-N |
| XLogP | 4.61 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|