C24H36BrNO2 — CID 19201343
4-(2-bromo-4-ethylphenoxy)-N,N-dicyclohexylbutanamide (PubChem CID 19201343) has the molecular formula C24H36BrNO2 and a molecular weight of 450.46 g/mol. Its IUPAC name is 4-(2-bromo-4-ethylphenoxy)-N,N-dicyclohexylbutanamide.
| Compound Name | 4-(2-bromo-4-ethylphenoxy)-N,N-dicyclohexylbutanamide |
|---|---|
| PubChem CID | 19201343 |
| Molecular Formula | C24H36BrNO2 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 4-(2-bromo-4-ethylphenoxy)-N,N-dicyclohexylbutanamide |
| SMILES | CCc1ccc(OCCCC(=O)N(C2CCCCC2)C2CCCCC2)c(Br)c1 |
| InChI | InChI=1S/C24H36BrNO2/c1-2-19-15-16-23(22(25)18-19)28-17-9-14-24(27)26(20-10-5-3-6-11-20)21-12-7-4-8-13-21/h15-16,18,20-21H,2-14,17H2,1H3 |
| InChIKey | MBBWALBWTPBVDO-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|