C18H19BrFNO2 — CID 19202057
4-(2-bromo-4-ethylphenoxy)-N-(3-fluorophenyl)butanamide (PubChem CID 19202057) has the molecular formula C18H19BrFNO2 and a molecular weight of 380.26 g/mol. Its IUPAC name is 4-(2-bromo-4-ethylphenoxy)-N-(3-fluorophenyl)butanamide.
| Compound Name | 4-(2-bromo-4-ethylphenoxy)-N-(3-fluorophenyl)butanamide |
|---|---|
| PubChem CID | 19202057 |
| Molecular Formula | C18H19BrFNO2 |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 4-(2-bromo-4-ethylphenoxy)-N-(3-fluorophenyl)butanamide |
| SMILES | CCc1ccc(OCCCC(=O)Nc2cccc(F)c2)c(Br)c1 |
| InChI | InChI=1S/C18H19BrFNO2/c1-2-13-8-9-17(16(19)11-13)23-10-4-7-18(22)21-15-6-3-5-14(20)12-15/h3,5-6,8-9,11-12H,2,4,7,10H2,1H3,(H,21,22) |
| InChIKey | QZIYYXMDBMGGOT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|