C28H27ClN2O6 — CID 19203405
[4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-ethoxyphenyl] 2-(4-chloro-3,5-dimethylphenoxy)propanoate (PubChem CID 19203405) has the molecular formula C28H27ClN2O6 and a molecular weight of 522.99 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-ethoxyphenyl] 2-(4-chloro-3,5-dimethylphenoxy)propanoate.
| Compound Name | [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-ethoxyphenyl] 2-(4-chloro-3,5-dimethylphenoxy)propanoate |
|---|---|
| PubChem CID | 19203405 |
| Molecular Formula | C28H27ClN2O6 |
| Molecular Weight | 522.99 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-ethoxyphenyl] 2-(4-chloro-3,5-dimethylphenoxy)propanoate |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)NCc2ccco2)ccc1OC(=O)C(C)Oc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C28H27ClN2O6/c1-5-34-25-14-20(13-21(15-30)27(32)31-16-22-7-6-10-35-22)8-9-24(25)37-28(33)19(4)36-23-11-17(2)26(29)18(3)12-23/h6-14,19H,5,16H2,1-4H3,(H,31,32)/b21-13+ |
| InChIKey | FSYFDJKEOHEPEB-FYJGNVAPSA-N |
| XLogP | 5.54 |
| TPSA | 110.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.99 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|