C17H27NO2 — CID 19204171
2-(4-tert-butylphenoxy)-N,N-diethylpropanamide (PubChem CID 19204171) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N,N-diethylpropanamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 19204171 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H27NO2/c1-7-18(8-2)16(19)13(3)20-15-11-9-14(10-12-15)17(4,5)6/h9-13H,7-8H2,1-6H3 |
| InChIKey | PYHNFADQTXSFSA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |