C19H23N3O3S2 — CID 19204742
N-[4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxamide (PubChem CID 19204742) has the molecular formula C19H23N3O3S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is N-[4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 19204742 |
| Molecular Formula | C19H23N3O3S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-[4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CCOc1ccc(-c2nc(NC(=O)C3CSC(C)(C)N3C=O)sc2C)cc1 |
| InChI | InChI=1S/C19H23N3O3S2/c1-5-25-14-8-6-13(7-9-14)16-12(2)27-18(20-16)21-17(24)15-10-26-19(3,4)22(15)11-23/h6-9,11,15H,5,10H2,1-4H3,(H,20,21,24) |
| InChIKey | PCOQXANFOSXVQW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|