C18H17N3O2S2 — CID 19204783
N-(3-cyano-5-phenylthiophen-2-yl)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxamide (PubChem CID 19204783) has the molecular formula C18H17N3O2S2 and a molecular weight of 371.49 g/mol. Its IUPAC name is N-(3-cyano-5-phenylthiophen-2-yl)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(3-cyano-5-phenylthiophen-2-yl)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 19204783 |
| Molecular Formula | C18H17N3O2S2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | N-(3-cyano-5-phenylthiophen-2-yl)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CC1(C)SCC(C(=O)Nc2sc(-c3ccccc3)cc2C#N)N1C=O |
| InChI | InChI=1S/C18H17N3O2S2/c1-18(2)21(11-22)14(10-24-18)16(23)20-17-13(9-19)8-15(25-17)12-6-4-3-5-7-12/h3-8,11,14H,10H2,1-2H3,(H,20,23) |
| InChIKey | XJGKPGFYHMUILQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|