C16H17Cl2N3S — CID 19209454
6-(2,4-dichlorophenyl)-2-hexylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 19209454) has the molecular formula C16H17Cl2N3S and a molecular weight of 354.31 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-2-hexylimidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 6-(2,4-dichlorophenyl)-2-hexylimidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 19209454 |
| Molecular Formula | C16H17Cl2N3S |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-2-hexylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | CCCCCCc1nn2cc(-c3ccc(Cl)cc3Cl)nc2s1 |
| InChI | InChI=1S/C16H17Cl2N3S/c1-2-3-4-5-6-15-20-21-10-14(19-16(21)22-15)12-8-7-11(17)9-13(12)18/h7-10H,2-6H2,1H3 |
| InChIKey | KMNPMPXCEOWPEN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|