About 2-(4-bromophenyl)-6-methoxyimidazo[2,1-b][1,3]benzothiazole
2-(4-bromophenyl)-6-methoxyimidazo[2,1-b][1,3]benzothiazole (PubChem CID 19209621) has the molecular formula C16H11BrN2OS
and a molecular weight of 359.25 g/mol. Its IUPAC name is 2-(4-bromophenyl)-6-methoxyimidazo[2,1-b][1,3]benzothiazole.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-6-methoxyimidazo[2,1-b][1,3]benzothiazole |
| PubChem CID | 19209621 |
| Molecular Formula | C16H11BrN2OS |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 2-(4-bromophenyl)-6-methoxyimidazo[2,1-b][1,3]benzothiazole |
| SMILES | COc1ccc2c(c1)sc1nc(-c3ccc(Br)cc3)cn12 |
| InChI | InChI=1S/C16H11BrN2OS/c1-20-12-6-7-14-15(8-12)21-16-18-13(9-19(14)16)10-2-4-11(17)5-3-10/h2-9H,1H3 |
| InChIKey | BYARTIHARQIFTI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-bromophenyl)-6-methoxyimidazo[2,1-b][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-6-methoxyimidazo[2,1-b][1,3]benzothiazole?
The IUPAC name of 2-(4-bromophenyl)-6-methoxyimidazo[2,1-b][1,3]benzothiazole (CID 19209621) is 2-(4-bromophenyl)-6-methoxyimidazo[2,1-b][1,3]benzothiazole.
What is the SMILES notation for 2-(4-bromophenyl)-6-methoxyimidazo[2,1-b][1,3]benzothiazole?
The canonical SMILES for 2-(4-bromophenyl)-6-methoxyimidazo[2,1-b][1,3]benzothiazole is COc1ccc2c(c1)sc1nc(-c3ccc(Br)cc3)cn12.
What is the InChIKey of 2-(4-bromophenyl)-6-methoxyimidazo[2,1-b][1,3]benzothiazole?
The InChIKey is BYARTIHARQIFTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11BrN2OS/c1-20-12-6-7-14-15(8-12)21-16-18-13(9-19(14)16)10-2-4-11(17)5-3-10/h2-9H,1H3.
What are the key properties of 2-(4-bromophenyl)-6-methoxyimidazo[2,1-b][1,3]benzothiazole?
2-(4-bromophenyl)-6-methoxyimidazo[2,1-b][1,3]benzothiazole has a molecular weight of 359.25 g/mol, XLogP of 4.99, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-6-methoxyimidazo[2,1-b][1,3]benzothiazole is sourced from PubChem (CID 19209621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).