About 1,8-dimethyl-2-phenylimidazo[2,1-b][1,3]benzothiazole
1,8-dimethyl-2-phenylimidazo[2,1-b][1,3]benzothiazole (PubChem CID 19209692) has the molecular formula C17H14N2S
and a molecular weight of 278.38 g/mol. Its IUPAC name is 1,8-dimethyl-2-phenylimidazo[2,1-b][1,3]benzothiazole.
Molecular Properties
| Compound Name | 1,8-dimethyl-2-phenylimidazo[2,1-b][1,3]benzothiazole |
| PubChem CID | 19209692 |
| Molecular Formula | C17H14N2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1,8-dimethyl-2-phenylimidazo[2,1-b][1,3]benzothiazole |
| SMILES | Cc1cccc2sc3nc(-c4ccccc4)c(C)n3c12 |
| InChI | InChI=1S/C17H14N2S/c1-11-7-6-10-14-16(11)19-12(2)15(18-17(19)20-14)13-8-4-3-5-9-13/h3-10H,1-2H3 |
| InChIKey | ZNNPEHPBBOKMAL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,8-dimethyl-2-phenylimidazo[2,1-b][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dimethyl-2-phenylimidazo[2,1-b][1,3]benzothiazole?
The IUPAC name of 1,8-dimethyl-2-phenylimidazo[2,1-b][1,3]benzothiazole (CID 19209692) is 1,8-dimethyl-2-phenylimidazo[2,1-b][1,3]benzothiazole.
What is the SMILES notation for 1,8-dimethyl-2-phenylimidazo[2,1-b][1,3]benzothiazole?
The canonical SMILES for 1,8-dimethyl-2-phenylimidazo[2,1-b][1,3]benzothiazole is Cc1cccc2sc3nc(-c4ccccc4)c(C)n3c12.
What is the InChIKey of 1,8-dimethyl-2-phenylimidazo[2,1-b][1,3]benzothiazole?
The InChIKey is ZNNPEHPBBOKMAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2S/c1-11-7-6-10-14-16(11)19-12(2)15(18-17(19)20-14)13-8-4-3-5-9-13/h3-10H,1-2H3.
What are the key properties of 1,8-dimethyl-2-phenylimidazo[2,1-b][1,3]benzothiazole?
1,8-dimethyl-2-phenylimidazo[2,1-b][1,3]benzothiazole has a molecular weight of 278.38 g/mol, XLogP of 4.83, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dimethyl-2-phenylimidazo[2,1-b][1,3]benzothiazole is sourced from PubChem (CID 19209692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).