C16H17N3S — CID 19209802
2-ethyl-6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 19209802) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-ethyl-6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 2-ethyl-6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 19209802 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-ethyl-6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | CCc1nn2cc(-c3ccc4c(c3)CCCC4)nc2s1 |
| InChI | InChI=1S/C16H17N3S/c1-2-15-18-19-10-14(17-16(19)20-15)13-8-7-11-5-3-4-6-12(11)9-13/h7-10H,2-6H2,1H3 |
| InChIKey | CFPTXFQTHCFIQM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |