C23H24BrN5O4S — CID 19213381
2-[[5-[(4-bromo-2-propan-2-ylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 19213381) has the molecular formula C23H24BrN5O4S and a molecular weight of 546.45 g/mol. Its IUPAC name is 2-[[5-[(4-bromo-2-propan-2-ylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[5-[(4-bromo-2-propan-2-ylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 19213381 |
| Molecular Formula | C23H24BrN5O4S |
| Molecular Weight | 546.45 g/mol |
| Exact Mass | 545.07 |
| IUPAC Name | 2-[[5-[(4-bromo-2-propan-2-ylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | C=CCn1c(COc2ccc(Br)cc2C(C)C)nnc1SCC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H24BrN5O4S/c1-4-11-28-21(13-33-20-10-5-16(24)12-19(20)15(2)3)26-27-23(28)34-14-22(30)25-17-6-8-18(9-7-17)29(31)32/h4-10,12,15H,1,11,13-14H2,2-3H3,(H,25,30) |
| InChIKey | LDKADAPMPQEKDX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|