C18H19IN2 — CID 19214757
5-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[1,2-a]pyridine;hydroiodide (PubChem CID 19214757) has the molecular formula C18H19IN2 and a molecular weight of 390.27 g/mol. Its IUPAC name is 5-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[1,2-a]pyridine;hydroiodide.
| Compound Name | 5-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[1,2-a]pyridine;hydroiodide |
|---|---|
| PubChem CID | 19214757 |
| Molecular Formula | C18H19IN2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 5-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[1,2-a]pyridine;hydroiodide |
| SMILES | Cc1cccc2nc(-c3ccc4c(c3)CCCC4)cn12.I |
| InChI | InChI=1S/C18H18N2.HI/c1-13-5-4-8-18-19-17(12-20(13)18)16-10-9-14-6-2-3-7-15(14)11-16;/h4-5,8-12H,2-3,6-7H2,1H3;1H |
| InChIKey | KNTKAYLCMCYJHI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|