About 1-benzylpiperidin-4-one
1-benzylpiperidin-4-one (PubChem CID 19220) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-benzylpiperidin-4-one.
Molecular Properties
| Compound Name | 1-benzylpiperidin-4-one |
| PubChem CID | 19220 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1-benzylpiperidin-4-one |
| SMILES | O=C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C12H15NO/c14-12-6-8-13(9-7-12)10-11-4-2-1-3-5-11/h1-5H,6-10H2 |
| InChIKey | SJZKULRDWHPHGG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylpiperidin-4-one?
The IUPAC name of 1-benzylpiperidin-4-one (CID 19220) is 1-benzylpiperidin-4-one.
What is the SMILES notation for 1-benzylpiperidin-4-one?
The canonical SMILES for 1-benzylpiperidin-4-one is O=C1CCN(Cc2ccccc2)CC1.
What is the InChIKey of 1-benzylpiperidin-4-one?
The InChIKey is SJZKULRDWHPHGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO/c14-12-6-8-13(9-7-12)10-11-4-2-1-3-5-11/h1-5H,6-10H2.
What are the key properties of 1-benzylpiperidin-4-one?
1-benzylpiperidin-4-one has a molecular weight of 189.26 g/mol, XLogP of 1.85, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylpiperidin-4-one is sourced from PubChem (CID 19220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).