C16H18N2O — CID 19224341
N-(2,4-dimethylphenyl)-4,6-dimethylpyridine-2-carboxamide (PubChem CID 19224341) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4,6-dimethylpyridine-2-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-4,6-dimethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 19224341 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4,6-dimethylpyridine-2-carboxamide |
| SMILES | Cc1cc(C)nc(C(=O)Nc2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C16H18N2O/c1-10-5-6-14(12(3)7-10)18-16(19)15-9-11(2)8-13(4)17-15/h5-9H,1-4H3,(H,18,19) |
| InChIKey | YLDNDZBVWPPSBD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |