C28H28N2O5 — CID 19225163
4-hydroxy-2-(2-methoxyphenyl)-4-methyl-6-oxo-1-N,3-N-diphenylcyclohexane-1,3-dicarboxamide (PubChem CID 19225163) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is 4-hydroxy-2-(2-methoxyphenyl)-4-methyl-6-oxo-1-N,3-N-diphenylcyclohexane-1,3-dicarboxamide.
| Compound Name | 4-hydroxy-2-(2-methoxyphenyl)-4-methyl-6-oxo-1-N,3-N-diphenylcyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19225163 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 4-hydroxy-2-(2-methoxyphenyl)-4-methyl-6-oxo-1-N,3-N-diphenylcyclohexane-1,3-dicarboxamide |
| SMILES | COc1ccccc1C1C(C(=O)Nc2ccccc2)C(=O)CC(C)(O)C1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C28H28N2O5/c1-28(34)17-21(31)24(26(32)29-18-11-5-3-6-12-18)23(20-15-9-10-16-22(20)35-2)25(28)27(33)30-19-13-7-4-8-14-19/h3-16,23-25,34H,17H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | IHEDJNKGQMUFBK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|