C19H18BrNO2 — CID 19225293
5-bromo-N-(2,6-diethylphenyl)-1-benzofuran-2-carboxamide (PubChem CID 19225293) has the molecular formula C19H18BrNO2 and a molecular weight of 372.26 g/mol. Its IUPAC name is 5-bromo-N-(2,6-diethylphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-(2,6-diethylphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19225293 |
| Molecular Formula | C19H18BrNO2 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 5-bromo-N-(2,6-diethylphenyl)-1-benzofuran-2-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C19H18BrNO2/c1-3-12-6-5-7-13(4-2)18(12)21-19(22)17-11-14-10-15(20)8-9-16(14)23-17/h5-11H,3-4H2,1-2H3,(H,21,22) |
| InChIKey | DFGWZOIXHDLKEA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |