C17H17Cl2NO2 — CID 19226004
N-(3,4-dichlorophenyl)-3-(4-ethoxyphenyl)propanamide (PubChem CID 19226004) has the molecular formula C17H17Cl2NO2 and a molecular weight of 338.23 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-(4-ethoxyphenyl)propanamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-(4-ethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 19226004 |
| Molecular Formula | C17H17Cl2NO2 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-(4-ethoxyphenyl)propanamide |
| SMILES | CCOc1ccc(CCC(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H17Cl2NO2/c1-2-22-14-7-3-12(4-8-14)5-10-17(21)20-13-6-9-15(18)16(19)11-13/h3-4,6-9,11H,2,5,10H2,1H3,(H,20,21) |
| InChIKey | UBCCFLMZYPUYJP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |