C23H26N2O2S2 — CID 19227818
2-(4-tert-butylphenoxy)-N-(4-cyano-7-methyl-1-sulfanylidene-5,6,7,8-tetrahydroisothiochromen-3-yl)acetamide (PubChem CID 19227818) has the molecular formula C23H26N2O2S2 and a molecular weight of 426.61 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-(4-cyano-7-methyl-1-sulfanylidene-5,6,7,8-tetrahydroisothiochromen-3-yl)acetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-(4-cyano-7-methyl-1-sulfanylidene-5,6,7,8-tetrahydroisothiochromen-3-yl)acetamide |
|---|---|
| PubChem CID | 19227818 |
| Molecular Formula | C23H26N2O2S2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-(4-cyano-7-methyl-1-sulfanylidene-5,6,7,8-tetrahydroisothiochromen-3-yl)acetamide |
| SMILES | CC1CCc2c(C#N)c(NC(=O)COc3ccc(C(C)(C)C)cc3)sc(=S)c2C1 |
| InChI | InChI=1S/C23H26N2O2S2/c1-14-5-10-17-18(11-14)22(28)29-21(19(17)12-24)25-20(26)13-27-16-8-6-15(7-9-16)23(2,3)4/h6-9,14H,5,10-11,13H2,1-4H3,(H,25,26) |
| InChIKey | CGVDQNFZKUWVRN-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ester_A(5)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|