C22H18N4O5S2 — CID 19228396
N-(4-cyano-7-methyl-1-sulfanylidene-5,6,7,8-tetrahydroisothiochromen-3-yl)-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 19228396) has the molecular formula C22H18N4O5S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is N-(4-cyano-7-methyl-1-sulfanylidene-5,6,7,8-tetrahydroisothiochromen-3-yl)-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-(4-cyano-7-methyl-1-sulfanylidene-5,6,7,8-tetrahydroisothiochromen-3-yl)-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 19228396 |
| Molecular Formula | C22H18N4O5S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | N-(4-cyano-7-methyl-1-sulfanylidene-5,6,7,8-tetrahydroisothiochromen-3-yl)-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | CC1CCc2c(C#N)c(NC(=O)CCN3C(=O)c4cccc([N+](=O)[O-])c4C3=O)sc(=S)c2C1 |
| InChI | InChI=1S/C22H18N4O5S2/c1-11-5-6-12-14(9-11)22(32)33-19(15(12)10-23)24-17(27)7-8-25-20(28)13-3-2-4-16(26(30)31)18(13)21(25)29/h2-4,11H,5-9H2,1H3,(H,24,27) |
| InChIKey | SBNRFZCJQNPHCQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ester_A(5)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|