C8H3Cl2F3N2 — CID 19232
4,5-dichloro-2-(trifluoromethyl)-1H-benzimidazole (PubChem CID 19232) has the molecular formula C8H3Cl2F3N2 and a molecular weight of 255.03 g/mol. Its IUPAC name is 4,5-dichloro-2-(trifluoromethyl)-1H-benzimidazole.
| Compound Name | 4,5-dichloro-2-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 19232 |
| Molecular Formula | C8H3Cl2F3N2 |
| Molecular Weight | 255.03 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | 4,5-dichloro-2-(trifluoromethyl)-1H-benzimidazole |
| SMILES | FC(F)(F)c1nc2c(Cl)c(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C8H3Cl2F3N2/c9-3-1-2-4-6(5(3)10)15-7(14-4)8(11,12)13/h1-2H,(H,14,15) |
| InChIKey | KSROTSBULDYPKA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.03 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |