C20H14ClN5O7 — CID 19234062
2-(4-chlorophenyl)-7-methylimidazo[1,2-a]pyridine;2,4,6-trinitrophenol (PubChem CID 19234062) has the molecular formula C20H14ClN5O7 and a molecular weight of 471.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-7-methylimidazo[1,2-a]pyridine;2,4,6-trinitrophenol.
| Compound Name | 2-(4-chlorophenyl)-7-methylimidazo[1,2-a]pyridine;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 19234062 |
| Molecular Formula | C20H14ClN5O7 |
| Molecular Weight | 471.81 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | 2-(4-chlorophenyl)-7-methylimidazo[1,2-a]pyridine;2,4,6-trinitrophenol |
| SMILES | Cc1ccn2cc(-c3ccc(Cl)cc3)nc2c1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H11ClN2.C6H3N3O7/c1-10-6-7-17-9-13(16-14(17)8-10)11-2-4-12(15)5-3-11;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h2-9H,1H3;1-2,10H |
| InChIKey | MOMUROJLTHNBJY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 166.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.81 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|