C21H17N5O8 — CID 19234073
2-(2-methoxyphenyl)-7-methylimidazo[1,2-a]pyridine;2,4,6-trinitrophenol (PubChem CID 19234073) has the molecular formula C21H17N5O8 and a molecular weight of 467.39 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-7-methylimidazo[1,2-a]pyridine;2,4,6-trinitrophenol.
| Compound Name | 2-(2-methoxyphenyl)-7-methylimidazo[1,2-a]pyridine;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 19234073 |
| Molecular Formula | C21H17N5O8 |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-(2-methoxyphenyl)-7-methylimidazo[1,2-a]pyridine;2,4,6-trinitrophenol |
| SMILES | COc1ccccc1-c1cn2ccc(C)cc2n1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H14N2O.C6H3N3O7/c1-11-7-8-17-10-13(16-15(17)9-11)12-5-3-4-6-14(12)18-2;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h3-10H,1-2H3;1-2,10H |
| InChIKey | KXPBPTNCXAUXCI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 176.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|