C14H12BrIN2O — CID 19238090
6-bromo-2-(4-methoxyphenyl)imidazo[1,2-a]pyridine;hydroiodide (PubChem CID 19238090) has the molecular formula C14H12BrIN2O and a molecular weight of 431.07 g/mol. Its IUPAC name is 6-bromo-2-(4-methoxyphenyl)imidazo[1,2-a]pyridine;hydroiodide.
| Compound Name | 6-bromo-2-(4-methoxyphenyl)imidazo[1,2-a]pyridine;hydroiodide |
|---|---|
| PubChem CID | 19238090 |
| Molecular Formula | C14H12BrIN2O |
| Molecular Weight | 431.07 g/mol |
| Exact Mass | 429.92 |
| IUPAC Name | 6-bromo-2-(4-methoxyphenyl)imidazo[1,2-a]pyridine;hydroiodide |
| SMILES | COc1ccc(-c2cn3cc(Br)ccc3n2)cc1.I |
| InChI | InChI=1S/C14H11BrN2O.HI/c1-18-12-5-2-10(3-6-12)13-9-17-8-11(15)4-7-14(17)16-13;/h2-9H,1H3;1H |
| InChIKey | OFYMRBQWAXKIDG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.07 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|