About 2-methylpropanehydrazide
2-methylpropanehydrazide (PubChem CID 19239) has the molecular formula C4H10N2O
and a molecular weight of 102.14 g/mol. Its IUPAC name is 2-methylpropanehydrazide.
Molecular Properties
| Compound Name | 2-methylpropanehydrazide |
| PubChem CID | 19239 |
| Molecular Formula | C4H10N2O |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.08 |
| IUPAC Name | 2-methylpropanehydrazide |
| SMILES | CC(C)C(=O)NN |
| InChI | InChI=1S/C4H10N2O/c1-3(2)4(7)6-5/h3H,5H2,1-2H3,(H,6,7) |
| InChIKey | PLNNJQXIITYYTN-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanehydrazide?
The IUPAC name of 2-methylpropanehydrazide (CID 19239) is 2-methylpropanehydrazide.
What is the SMILES notation for 2-methylpropanehydrazide?
The canonical SMILES for 2-methylpropanehydrazide is CC(C)C(=O)NN.
What is the InChIKey of 2-methylpropanehydrazide?
The InChIKey is PLNNJQXIITYYTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O/c1-3(2)4(7)6-5/h3H,5H2,1-2H3,(H,6,7).
What are the key properties of 2-methylpropanehydrazide?
2-methylpropanehydrazide has a molecular weight of 102.14 g/mol, XLogP of -0.37, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanehydrazide is sourced from PubChem (CID 19239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).