About 2-cyclopentylsulfanyl-4,5-dihydro-1H-imidazole;hydrobromide
2-cyclopentylsulfanyl-4,5-dihydro-1H-imidazole;hydrobromide (PubChem CID 19240298) has the molecular formula C8H15BrN2S
and a molecular weight of 251.19 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-4,5-dihydro-1H-imidazole;hydrobromide.
Molecular Properties
| Compound Name | 2-cyclopentylsulfanyl-4,5-dihydro-1H-imidazole;hydrobromide |
| PubChem CID | 19240298 |
| Molecular Formula | C8H15BrN2S |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 2-cyclopentylsulfanyl-4,5-dihydro-1H-imidazole;hydrobromide |
| SMILES | Br.C1CCC(SC2=NCCN2)C1 |
| InChI | InChI=1S/C8H14N2S.BrH/c1-2-4-7(3-1)11-8-9-5-6-10-8;/h7H,1-6H2,(H,9,10);1H |
| InChIKey | BHODNMVJUPQRTM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopentylsulfanyl-4,5-dihydro-1H-imidazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentylsulfanyl-4,5-dihydro-1H-imidazole;hydrobromide?
The IUPAC name of 2-cyclopentylsulfanyl-4,5-dihydro-1H-imidazole;hydrobromide (CID 19240298) is 2-cyclopentylsulfanyl-4,5-dihydro-1H-imidazole;hydrobromide.
What is the SMILES notation for 2-cyclopentylsulfanyl-4,5-dihydro-1H-imidazole;hydrobromide?
The canonical SMILES for 2-cyclopentylsulfanyl-4,5-dihydro-1H-imidazole;hydrobromide is Br.C1CCC(SC2=NCCN2)C1.
What is the InChIKey of 2-cyclopentylsulfanyl-4,5-dihydro-1H-imidazole;hydrobromide?
The InChIKey is BHODNMVJUPQRTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2S.BrH/c1-2-4-7(3-1)11-8-9-5-6-10-8;/h7H,1-6H2,(H,9,10);1H.
What are the key properties of 2-cyclopentylsulfanyl-4,5-dihydro-1H-imidazole;hydrobromide?
2-cyclopentylsulfanyl-4,5-dihydro-1H-imidazole;hydrobromide has a molecular weight of 251.19 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentylsulfanyl-4,5-dihydro-1H-imidazole;hydrobromide is sourced from PubChem (CID 19240298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).