C21H32N4O3S — CID 19241899
N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-4-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)butanamide (PubChem CID 19241899) has the molecular formula C21H32N4O3S and a molecular weight of 420.58 g/mol. Its IUPAC name is N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-4-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)butanamide.
| Compound Name | N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-4-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)butanamide |
|---|---|
| PubChem CID | 19241899 |
| Molecular Formula | C21H32N4O3S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-4-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)butanamide |
| SMILES | CCC(CC)c1nnc(NC(=O)CCCN2C(=O)C3CCC(C)(C2=O)C3(C)C)s1 |
| InChI | InChI=1S/C21H32N4O3S/c1-6-13(7-2)16-23-24-19(29-16)22-15(26)9-8-12-25-17(27)14-10-11-21(5,18(25)28)20(14,3)4/h13-14H,6-12H2,1-5H3,(H,22,24,26) |
| InChIKey | DBFHIUUJCLSBBY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|