C16H24N2O3 — CID 19241919
N-prop-2-enyl-3-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanamide (PubChem CID 19241919) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-prop-2-enyl-3-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanamide.
| Compound Name | N-prop-2-enyl-3-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanamide |
|---|---|
| PubChem CID | 19241919 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N-prop-2-enyl-3-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanamide |
| SMILES | C=CCNC(=O)CCN1C(=O)C2CCC(C)(C1=O)C2(C)C |
| InChI | InChI=1S/C16H24N2O3/c1-5-9-17-12(19)7-10-18-13(20)11-6-8-16(4,14(18)21)15(11,2)3/h5,11H,1,6-10H2,2-4H3,(H,17,19) |
| InChIKey | AFMPIYKVWLKJIA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|