C29H30FN3O2 — CID 19242521
4-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]-1-(3-fluorophenyl)pyrrolidin-2-one (PubChem CID 19242521) has the molecular formula C29H30FN3O2 and a molecular weight of 471.58 g/mol. Its IUPAC name is 4-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]-1-(3-fluorophenyl)pyrrolidin-2-one.
| Compound Name | 4-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]-1-(3-fluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 19242521 |
| Molecular Formula | C29H30FN3O2 |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 4-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]-1-(3-fluorophenyl)pyrrolidin-2-one |
| SMILES | CC(C)(C)c1ccc(OCCn2c(C3CC(=O)N(c4cccc(F)c4)C3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C29H30FN3O2/c1-29(2,3)21-11-13-24(14-12-21)35-16-15-32-26-10-5-4-9-25(26)31-28(32)20-17-27(34)33(19-20)23-8-6-7-22(30)18-23/h4-14,18,20H,15-17,19H2,1-3H3 |
| InChIKey | WBUHNSZQHAXDJG-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |