C17H23N3O3 — CID 19243480
N,N-diethyl-2-(1-formyl-3-methyl-4-oxo-2,3-dihydro-1,5-benzodiazepin-5-yl)acetamide (PubChem CID 19243480) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N,N-diethyl-2-(1-formyl-3-methyl-4-oxo-2,3-dihydro-1,5-benzodiazepin-5-yl)acetamide.
| Compound Name | N,N-diethyl-2-(1-formyl-3-methyl-4-oxo-2,3-dihydro-1,5-benzodiazepin-5-yl)acetamide |
|---|---|
| PubChem CID | 19243480 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N,N-diethyl-2-(1-formyl-3-methyl-4-oxo-2,3-dihydro-1,5-benzodiazepin-5-yl)acetamide |
| SMILES | CCN(CC)C(=O)CN1C(=O)C(C)CN(C=O)c2ccccc21 |
| InChI | InChI=1S/C17H23N3O3/c1-4-18(5-2)16(22)11-20-15-9-7-6-8-14(15)19(12-21)10-13(3)17(20)23/h6-9,12-13H,4-5,10-11H2,1-3H3 |
| InChIKey | OAJDHGUXDYNTQA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|